C24H26F3N5O — CID 171504343
6-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]cinnolin-4-amine (PubChem CID 171504343) has the molecular formula C24H26F3N5O and a molecular weight of 457.50 g/mol. Its IUPAC name is 6-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]cinnolin-4-amine.
| Compound Name | 6-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 171504343 |
| Molecular Formula | C24H26F3N5O |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 6-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]cinnolin-4-amine |
| SMILES | C[C@@H](Nc1cnnc2ccc(N3CCN4CCOC[C@H]4C3)cc12)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C24H26F3N5O/c1-15(18-3-2-4-19(23(18)25)24(26)27)29-22-12-28-30-21-6-5-16(11-20(21)22)32-8-7-31-9-10-33-14-17(31)13-32/h2-6,11-12,15,17,24H,7-10,13-14H2,1H3,(H,29,30)/t15-,17-/m1/s1 |
| InChIKey | CBVHZBWMVLFQHK-NVXWUHKLSA-N |
| XLogP | 4.40 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |