C26H29F2N5O — CID 171503927
6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethyl]cinnolin-4-amine (PubChem CID 171503927) has the molecular formula C26H29F2N5O and a molecular weight of 465.55 g/mol. Its IUPAC name is 6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethyl]cinnolin-4-amine.
| Compound Name | 6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 171503927 |
| Molecular Formula | C26H29F2N5O |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethyl]cinnolin-4-amine |
| SMILES | C[C@@H](Nc1cnnc2ccc(N3CCN4CCOC[C@@H]4C3)cc12)c1cccc2c1CCC2(F)F |
| InChI | InChI=1S/C26H29F2N5O/c1-17(20-3-2-4-23-21(20)7-8-26(23,27)28)30-25-14-29-31-24-6-5-18(13-22(24)25)33-10-9-32-11-12-34-16-19(32)15-33/h2-6,13-14,17,19H,7-12,15-16H2,1H3,(H,30,31)/t17-,19+/m1/s1 |
| InChIKey | QYZPOHJGZLMRTN-MJGOQNOKSA-N |
| XLogP | 4.36 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |