C24H26F3N5O2 — CID 171504022
3-[(1R)-1-[[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]cinnolin-4-yl]amino]ethyl]-5-(trifluoromethyl)phenol (PubChem CID 171504022) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is 3-[(1R)-1-[[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]cinnolin-4-yl]amino]ethyl]-5-(trifluoromethyl)phenol.
| Compound Name | 3-[(1R)-1-[[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]cinnolin-4-yl]amino]ethyl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171504022 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3-[(1R)-1-[[6-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]cinnolin-4-yl]amino]ethyl]-5-(trifluoromethyl)phenol |
| SMILES | C[C@@H](Nc1cnnc2ccc(N3CCN4CCOC[C@@H]4C3)cc12)c1cc(O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N5O2/c1-15(16-8-17(24(25,26)27)10-20(33)9-16)29-23-12-28-30-22-3-2-18(11-21(22)23)32-5-4-31-6-7-34-14-19(31)13-32/h2-3,8-12,15,19,33H,4-7,13-14H2,1H3,(H,29,30)/t15-,19+/m1/s1 |
| InChIKey | MDDAUQRILTYPMK-BEFAXECRSA-N |
| XLogP | 4.05 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |