C18H21N3O3S — CID 171504512
4-amino-2-[1-(benzenesulfonyl)azepan-3-yl]pyridine-3-carbaldehyde (PubChem CID 171504512) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-amino-2-[1-(benzenesulfonyl)azepan-3-yl]pyridine-3-carbaldehyde.
| Compound Name | 4-amino-2-[1-(benzenesulfonyl)azepan-3-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 171504512 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-amino-2-[1-(benzenesulfonyl)azepan-3-yl]pyridine-3-carbaldehyde |
| SMILES | Nc1ccnc(C2CCCCN(S(=O)(=O)c3ccccc3)C2)c1C=O |
| InChI | InChI=1S/C18H21N3O3S/c19-17-9-10-20-18(16(17)13-22)14-6-4-5-11-21(12-14)25(23,24)15-7-2-1-3-8-15/h1-3,7-10,13-14H,4-6,11-12H2,(H2,19,20) |
| InChIKey | KUJDPUUVNFFXDP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|