C15H23N3O3 — CID 171509767
1-amino-N-(2-phenylethyl)pyrrolidine-2-carboxamide;methyl formate (PubChem CID 171509767) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-amino-N-(2-phenylethyl)pyrrolidine-2-carboxamide;methyl formate.
| Compound Name | 1-amino-N-(2-phenylethyl)pyrrolidine-2-carboxamide;methyl formate |
|---|---|
| PubChem CID | 171509767 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-amino-N-(2-phenylethyl)pyrrolidine-2-carboxamide;methyl formate |
| SMILES | COC=O.NN1CCCC1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C13H19N3O.C2H4O2/c14-16-10-4-7-12(16)13(17)15-9-8-11-5-2-1-3-6-11;1-4-2-3/h1-3,5-6,12H,4,7-10,14H2,(H,15,17);2H,1H3 |
| InChIKey | RBZXZJJIKALVNS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|