About 5-bromo-3,4-difluoro-2-iodoaniline
5-bromo-3,4-difluoro-2-iodoaniline (PubChem CID 171518505) has the molecular formula C6H3BrF2IN
and a molecular weight of 333.90 g/mol. Its IUPAC name is 5-bromo-3,4-difluoro-2-iodoaniline.
Molecular Properties
| Compound Name | 5-bromo-3,4-difluoro-2-iodoaniline |
| PubChem CID | 171518505 |
| Molecular Formula | C6H3BrF2IN |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 332.85 |
| IUPAC Name | 5-bromo-3,4-difluoro-2-iodoaniline |
| SMILES | Nc1cc(Br)c(F)c(F)c1I |
| InChI | InChI=1S/C6H3BrF2IN/c7-2-1-3(11)6(10)5(9)4(2)8/h1H,11H2 |
| InChIKey | AWLAAOJDAOLQCM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3,4-difluoro-2-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,4-difluoro-2-iodoaniline?
The IUPAC name of 5-bromo-3,4-difluoro-2-iodoaniline (CID 171518505) is 5-bromo-3,4-difluoro-2-iodoaniline.
What is the SMILES notation for 5-bromo-3,4-difluoro-2-iodoaniline?
The canonical SMILES for 5-bromo-3,4-difluoro-2-iodoaniline is Nc1cc(Br)c(F)c(F)c1I.
What is the InChIKey of 5-bromo-3,4-difluoro-2-iodoaniline?
The InChIKey is AWLAAOJDAOLQCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrF2IN/c7-2-1-3(11)6(10)5(9)4(2)8/h1H,11H2.
What are the key properties of 5-bromo-3,4-difluoro-2-iodoaniline?
5-bromo-3,4-difluoro-2-iodoaniline has a molecular weight of 333.90 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,4-difluoro-2-iodoaniline is sourced from PubChem (CID 171518505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).