C18H23F3N2O4 — CID 171519899
2-acetamido-3-methylbutanoic acid;1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-2-one (PubChem CID 171519899) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is 2-acetamido-3-methylbutanoic acid;1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-2-one.
| Compound Name | 2-acetamido-3-methylbutanoic acid;1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171519899 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-acetamido-3-methylbutanoic acid;1-[(2,3,5-trifluorophenyl)methyl]pyrrolidin-2-one |
| SMILES | CC(=O)NC(C(=O)O)C(C)C.O=C1CCCN1Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H10F3NO.C7H13NO3/c12-8-4-7(11(14)9(13)5-8)6-15-3-1-2-10(15)16;1-4(2)6(7(10)11)8-5(3)9/h4-5H,1-3,6H2;4,6H,1-3H3,(H,8,9)(H,10,11) |
| InChIKey | NMJKZXSWXWWCDT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|