C32H16F6O3 — CID 171520024
10,16-bis[4-(trifluoromethyl)phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-12,14-dicarbaldehyde (PubChem CID 171520024) has the molecular formula C32H16F6O3 and a molecular weight of 562.47 g/mol. Its IUPAC name is 10,16-bis[4-(trifluoromethyl)phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-12,14-dicarbaldehyde.
| Compound Name | 10,16-bis[4-(trifluoromethyl)phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-12,14-dicarbaldehyde |
|---|---|
| PubChem CID | 171520024 |
| Molecular Formula | C32H16F6O3 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 10,16-bis[4-(trifluoromethyl)phenyl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene-12,14-dicarbaldehyde |
| SMILES | O=Cc1cc(-c2ccc(C(F)(F)F)cc2)c2c3c(c(-c4ccc(C(F)(F)F)cc4)cc(C=O)c13)-c1ccccc1O2 |
| InChI | InChI=1S/C32H16F6O3/c33-31(34,35)21-9-5-17(6-10-21)24-13-19(15-39)27-20(16-40)14-25(18-7-11-22(12-8-18)32(36,37)38)30-29(27)28(24)23-3-1-2-4-26(23)41-30/h1-16H |
| InChIKey | GWCBXJSLVAGPCT-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|