C15H9Br2F3O3 — CID 174822916
2-bromo-1,3-benzodioxole;2-bromo-4-(trifluoromethyl)benzaldehyde (PubChem CID 174822916) has the molecular formula C15H9Br2F3O3 and a molecular weight of 454.04 g/mol. Its IUPAC name is 2-bromo-1,3-benzodioxole;2-bromo-4-(trifluoromethyl)benzaldehyde.
| Compound Name | 2-bromo-1,3-benzodioxole;2-bromo-4-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 174822916 |
| Molecular Formula | C15H9Br2F3O3 |
| Molecular Weight | 454.04 g/mol |
| Exact Mass | 451.89 |
| IUPAC Name | 2-bromo-1,3-benzodioxole;2-bromo-4-(trifluoromethyl)benzaldehyde |
| SMILES | BrC1Oc2ccccc2O1.O=Cc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C8H4BrF3O.C7H5BrO2/c9-7-3-6(8(10,11)12)2-1-5(7)4-13;8-7-9-5-3-1-2-4-6(5)10-7/h1-4H;1-4,7H |
| InChIKey | DTRCPWUUQPDGTA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.04 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|