C30H39N5O3 — CID 171521435
5-[4-[5-(4-methylpiperazin-1-yl)pent-1-ynyl]phenyl]-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 171521435) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 5-[4-[5-(4-methylpiperazin-1-yl)pent-1-ynyl]phenyl]-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-[4-[5-(4-methylpiperazin-1-yl)pent-1-ynyl]phenyl]-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 171521435 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 5-[4-[5-(4-methylpiperazin-1-yl)pent-1-ynyl]phenyl]-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | C[C@H](OC1CCCCO1)c1nccn1Cc1cc(-c2ccc(C#CCCCN3CCN(C)CC3)cc2)on1 |
| InChI | InChI=1S/C30H39N5O3/c1-24(37-29-9-5-7-21-36-29)30-31-14-16-35(30)23-27-22-28(38-32-27)26-12-10-25(11-13-26)8-4-3-6-15-34-19-17-33(2)18-20-34/h10-14,16,22,24,29H,3,5-7,9,15,17-21,23H2,1-2H3/t24-,29?/m0/s1 |
| InChIKey | VABCPXZOEWHQJH-CTLOQAHHSA-N |
| XLogP | 4.57 |
| TPSA | 68.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|