C29H29N7O3 — CID 171521406
3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-5-[4-(4-purin-7-ylbut-1-ynyl)phenyl]-1,2-oxazole (PubChem CID 171521406) has the molecular formula C29H29N7O3 and a molecular weight of 523.60 g/mol. Its IUPAC name is 3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-5-[4-(4-purin-7-ylbut-1-ynyl)phenyl]-1,2-oxazole.
| Compound Name | 3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-5-[4-(4-purin-7-ylbut-1-ynyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 171521406 |
| Molecular Formula | C29H29N7O3 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-5-[4-(4-purin-7-ylbut-1-ynyl)phenyl]-1,2-oxazole |
| SMILES | C[C@H](OC1CCCCO1)c1nccn1Cc1cc(-c2ccc(C#CCCn3cnc4ncncc43)cc2)on1 |
| InChI | InChI=1S/C29H29N7O3/c1-21(38-27-7-3-5-15-37-27)29-31-12-14-35(29)18-24-16-26(39-34-24)23-10-8-22(9-11-23)6-2-4-13-36-20-33-28-25(36)17-30-19-32-28/h8-12,14,16-17,19-21,27H,3-5,7,13,15,18H2,1H3/t21-,27?/m0/s1 |
| InChIKey | LBOMVAPQACBJEP-LWAJAQLZSA-N |
| XLogP | 4.77 |
| TPSA | 105.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|