C13H19F2IN4O3S — CID 171523933
[(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide (PubChem CID 171523933) has the molecular formula C13H19F2IN4O3S and a molecular weight of 476.29 g/mol. Its IUPAC name is [(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide.
| Compound Name | [(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide |
|---|---|
| PubChem CID | 171523933 |
| Molecular Formula | C13H19F2IN4O3S |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide |
| SMILES | C[n+]1ccn(C(=O)N2C[C@H](N3CCCS3(=O)=O)CC(F)(F)C2)c1.[I-] |
| InChI | InChI=1S/C13H19F2N4O3S.HI/c1-16-4-5-17(10-16)12(20)18-8-11(7-13(14,15)9-18)19-3-2-6-23(19,21)22;/h4-5,10-11H,2-3,6-9H2,1H3;1H/q+1;/p-1/t11-;/m1./s1 |
| InChIKey | DGFUCLLHWVXXHP-RFVHGSKJSA-M |
| XLogP | -2.97 |
| TPSA | 66.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|