C13H19F2N4O3S+ — CID 171523934
[(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone (PubChem CID 171523934) has the molecular formula C13H19F2N4O3S+ and a molecular weight of 349.38 g/mol. Its IUPAC name is [(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone.
| Compound Name | [(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 171523934 |
| Molecular Formula | C13H19F2N4O3S+ |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [(5R)-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-3,3-difluoropiperidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone |
| SMILES | C[n+]1ccn(C(=O)N2C[C@H](N3CCCS3(=O)=O)CC(F)(F)C2)c1 |
| InChI | InChI=1S/C13H19F2N4O3S/c1-16-4-5-17(10-16)12(20)18-8-11(7-13(14,15)9-18)19-3-2-6-23(19,21)22/h4-5,10-11H,2-3,6-9H2,1H3/q+1/t11-/m1/s1 |
| InChIKey | GQKVWYYZKFIZSH-LLVKDONJSA-N |
| XLogP | 0.03 |
| TPSA | 66.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|