C18H24N4OS2 — CID 17152534
N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-phenylpiperidine-4-carboxamide (PubChem CID 17152534) has the molecular formula C18H24N4OS2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-phenylpiperidine-4-carboxamide.
| Compound Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 17152534 |
| Molecular Formula | C18H24N4OS2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-1-phenylpiperidine-4-carboxamide |
| SMILES | CCC(C)Sc1nnc(NC(=O)C2CCN(c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C18H24N4OS2/c1-3-13(2)24-18-21-20-17(25-18)19-16(23)14-9-11-22(12-10-14)15-7-5-4-6-8-15/h4-8,13-14H,3,9-12H2,1-2H3,(H,19,20,23) |
| InChIKey | FVSFOWWKAOFWEF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|