C22H30ClN5O2 — CID 171525973
N-[5-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-2-methylphenyl]-N-(3-hydroxy-3-methylbutyl)formamide (PubChem CID 171525973) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is N-[5-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-2-methylphenyl]-N-(3-hydroxy-3-methylbutyl)formamide.
| Compound Name | N-[5-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-2-methylphenyl]-N-(3-hydroxy-3-methylbutyl)formamide |
|---|---|
| PubChem CID | 171525973 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[5-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-2-methylphenyl]-N-(3-hydroxy-3-methylbutyl)formamide |
| SMILES | Cc1ccc(Nc2nc(N3CCCCC3)ncc2Cl)cc1N(C=O)CCC(C)(C)O |
| InChI | InChI=1S/C22H30ClN5O2/c1-16-7-8-17(13-19(16)28(15-29)12-9-22(2,3)30)25-20-18(23)14-24-21(26-20)27-10-5-4-6-11-27/h7-8,13-15,30H,4-6,9-12H2,1-3H3,(H,24,25,26) |
| InChIKey | AHBFHSNFHRCOKW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|