C21H28N4O3 — CID 171527850
4-(6-amino-3-pyridinyl)piperazine-1-carbaldehyde;1-(4-methoxyphenyl)butan-1-one (PubChem CID 171527850) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-(6-amino-3-pyridinyl)piperazine-1-carbaldehyde;1-(4-methoxyphenyl)butan-1-one.
| Compound Name | 4-(6-amino-3-pyridinyl)piperazine-1-carbaldehyde;1-(4-methoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 171527850 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 4-(6-amino-3-pyridinyl)piperazine-1-carbaldehyde;1-(4-methoxyphenyl)butan-1-one |
| SMILES | CCCC(=O)c1ccc(OC)cc1.Nc1ccc(N2CCN(C=O)CC2)cn1 |
| InChI | InChI=1S/C11H14O2.C10H14N4O/c1-3-4-11(12)9-5-7-10(13-2)8-6-9;11-10-2-1-9(7-12-10)14-5-3-13(8-15)4-6-14/h5-8H,3-4H2,1-2H3;1-2,7-8H,3-6H2,(H2,11,12) |
| InChIKey | IMZAQFWJDGSGDY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|