C25H19B2F2N3O2 — CID 171527981
CID 171527981 (PubChem CID 171527981) has the molecular formula C25H19B2F2N3O2 and a molecular weight of 453.07 g/mol.
| Compound Name | CID 171527981 |
|---|---|
| PubChem CID | 171527981 |
| Molecular Formula | C25H19B2F2N3O2 |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)c1ccc(-c2cc(F)c(CN(C)Cc3ncccc3C=O)c(F)c2)c2ncccc12 |
| InChI | InChI=1S/C25H19B2F2N3O2/c1-32(13-23-15(14-33)4-2-8-30-23)12-19-21(28)10-16(11-22(19)29)17-6-7-20(25(26,27)34)18-5-3-9-31-24(17)18/h2-11,14,34H,12-13H2,1H3 |
| InChIKey | UQRVGYGEDMUQNQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|