C26H25B2FN4O2 — CID 171528165
CID 171528165 (PubChem CID 171528165) has the molecular formula C26H25B2FN4O2 and a molecular weight of 466.13 g/mol.
| Compound Name | CID 171528165 |
|---|---|
| PubChem CID | 171528165 |
| Molecular Formula | C26H25B2FN4O2 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | — |
| SMILES | [H]/N=C/c1c(-c2cc(F)c(CN(C)Cc3ncccc3C=O)c(C3CC3)c2)ccc(C([B])([B])O)c1N |
| InChI | InChI=1S/C26H25B2FN4O2/c1-33(13-24-16(14-34)3-2-8-32-24)12-21-19(15-4-5-15)9-17(10-23(21)29)18-6-7-22(26(27,28)35)25(31)20(18)11-30/h2-3,6-11,14-15,30,35H,4-5,12-13,31H2,1H3/b30-11+ |
| InChIKey | BOVDCGFGGCSFMX-KNBZMSCYSA-N |
| XLogP | 3.23 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|