C27H25BF2N4O4 — CID 166076857
CID 166076857 (PubChem CID 166076857) has the molecular formula C27H25BF2N4O4 and a molecular weight of 518.33 g/mol.
| Compound Name | CID 166076857 |
|---|---|
| PubChem CID | 166076857 |
| Molecular Formula | C27H25BF2N4O4 |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | — |
| SMILES | [B]C1(O)c2ncccc2C(=O)N1Cc1c(F)cc(-c2ccc(OCCOC3CC3)c(N)c2/C=N/C)cc1F |
| InChI | InChI=1S/C27H25BF2N4O4/c1-32-13-19-17(6-7-23(24(19)31)38-10-9-37-16-4-5-16)15-11-21(29)20(22(30)12-15)14-34-26(35)18-3-2-8-33-25(18)27(34,28)36/h2-3,6-8,11-13,16,36H,4-5,9-10,14,31H2,1H3/b32-13+ |
| InChIKey | MIHVEXLOPGQBJI-JJKQSNDFSA-N |
| XLogP | 3.14 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|