C26H22F3N3O3 — CID 171528497
2-[[4-[3-amino-4-(3-hydroxyoxetan-3-yl)-2-(methyliminomethyl)phenyl]-2,6-difluorophenyl]methyl]-7-fluoro-3H-isoindol-1-one (PubChem CID 171528497) has the molecular formula C26H22F3N3O3 and a molecular weight of 481.47 g/mol. Its IUPAC name is 2-[[4-[3-amino-4-(3-hydroxyoxetan-3-yl)-2-(methyliminomethyl)phenyl]-2,6-difluorophenyl]methyl]-7-fluoro-3H-isoindol-1-one.
| Compound Name | 2-[[4-[3-amino-4-(3-hydroxyoxetan-3-yl)-2-(methyliminomethyl)phenyl]-2,6-difluorophenyl]methyl]-7-fluoro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 171528497 |
| Molecular Formula | C26H22F3N3O3 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[[4-[3-amino-4-(3-hydroxyoxetan-3-yl)-2-(methyliminomethyl)phenyl]-2,6-difluorophenyl]methyl]-7-fluoro-3H-isoindol-1-one |
| SMILES | C/N=C/c1c(-c2cc(F)c(CN3Cc4cccc(F)c4C3=O)c(F)c2)ccc(C2(O)COC2)c1N |
| InChI | InChI=1S/C26H22F3N3O3/c1-31-9-17-16(5-6-19(24(17)30)26(34)12-35-13-26)15-7-21(28)18(22(29)8-15)11-32-10-14-3-2-4-20(27)23(14)25(32)33/h2-9,34H,10-13,30H2,1H3/b31-9+ |
| InChIKey | XNLQHJJLENXIDK-LODFRUGASA-N |
| XLogP | 3.78 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|