About CID 175616328
CID 175616328 (PubChem CID 175616328) has the molecular formula C15H7B2BrF4N2O
and a molecular weight of 408.75 g/mol.
Molecular Properties
| Compound Name | CID 175616328 |
| PubChem CID | 175616328 |
| Molecular Formula | C15H7B2BrF4N2O |
| Molecular Weight | 408.75 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | — |
| SMILES | [B]C1([B])c2ncccc2C(=O)N1Cc1c(F)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C15H7B2BrF4N2O/c16-14(17)12-8(2-1-3-23-12)13(25)24(14)6-9-10(15(20,21)22)4-7(18)5-11(9)19/h1-5H,6H2 |
| InChIKey | JLXZNFQHBHOURM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175616328 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175616328?
The IUPAC name of CID 175616328 (CID 175616328) is not available.
What is the SMILES notation for CID 175616328?
The canonical SMILES for CID 175616328 is [B]C1([B])c2ncccc2C(=O)N1Cc1c(F)cc(Br)cc1C(F)(F)F.
What is the InChIKey of CID 175616328?
The InChIKey is JLXZNFQHBHOURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7B2BrF4N2O/c16-14(17)12-8(2-1-3-23-12)13(25)24(14)6-9-10(15(20,21)22)4-7(18)5-11(9)19/h1-5H,6H2.
What are the key properties of CID 175616328?
CID 175616328 has a molecular weight of 408.75 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175616328 is sourced from PubChem (CID 175616328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).