C26H29F4N5O3S — CID 171531584
N-[3-[8-[(5S,6S)-6-fluoro-1-methyl-1,4-diazepan-5-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-2-methoxy-4-methylsulfonylaniline (PubChem CID 171531584) has the molecular formula C26H29F4N5O3S and a molecular weight of 567.61 g/mol. Its IUPAC name is N-[3-[8-[(5S,6S)-6-fluoro-1-methyl-1,4-diazepan-5-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-2-methoxy-4-methylsulfonylaniline.
| Compound Name | N-[3-[8-[(5S,6S)-6-fluoro-1-methyl-1,4-diazepan-5-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-2-methoxy-4-methylsulfonylaniline |
|---|---|
| PubChem CID | 171531584 |
| Molecular Formula | C26H29F4N5O3S |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | N-[3-[8-[(5S,6S)-6-fluoro-1-methyl-1,4-diazepan-5-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-2-methoxy-4-methylsulfonylaniline |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1nc2c([C@@H]3NCCN(C)C[C@@H]3F)cccn2c1CC(F)(F)F |
| InChI | InChI=1S/C26H29F4N5O3S/c1-34-13-11-32-24(19(27)16-34)18-6-5-12-35-22(15-26(28,29)30)20(33-25(18)35)7-4-10-31-21-9-8-17(39(3,36)37)14-23(21)38-2/h5-6,8-9,12,14,19,24,31-32H,10-11,13,15-16H2,1-3H3/t19-,24-/m0/s1 |
| InChIKey | MDFFYLFPEOHNSJ-CYFREDJKSA-N |
| XLogP | 3.23 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|