C28H32F3N5O3S — CID 171530796
2-methoxy-N-[3-[8-[(2R,5S)-7-methyl-1,7-diazaspiro[4.4]nonan-2-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-4-methylsulfonylaniline (PubChem CID 171530796) has the molecular formula C28H32F3N5O3S and a molecular weight of 575.66 g/mol. Its IUPAC name is 2-methoxy-N-[3-[8-[(2R,5S)-7-methyl-1,7-diazaspiro[4.4]nonan-2-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-4-methylsulfonylaniline.
| Compound Name | 2-methoxy-N-[3-[8-[(2R,5S)-7-methyl-1,7-diazaspiro[4.4]nonan-2-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-4-methylsulfonylaniline |
|---|---|
| PubChem CID | 171530796 |
| Molecular Formula | C28H32F3N5O3S |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 2-methoxy-N-[3-[8-[(2R,5S)-7-methyl-1,7-diazaspiro[4.4]nonan-2-yl]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynyl]-4-methylsulfonylaniline |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1nc2c([C@H]3CC[C@@]4(CCN(C)C4)N3)cccn2c1CC(F)(F)F |
| InChI | InChI=1S/C28H32F3N5O3S/c1-35-15-12-27(18-35)11-10-21(34-27)20-6-5-14-36-24(17-28(29,30)31)22(33-26(20)36)7-4-13-32-23-9-8-19(40(3,37)38)16-25(23)39-2/h5-6,8-9,14,16,21,32,34H,10-13,15,17-18H2,1-3H3/t21-,27+/m1/s1 |
| InChIKey | AGEJNYFTBJWWEH-ZBLYBZFDSA-N |
| XLogP | 3.81 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|