C29H33F3N4O4S — CID 167436588
2-methoxy-N-[3-[2-(1-methylpiperidin-4-yl)-7-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[3,2-f][1,4]benzoxazin-8-yl]prop-2-ynyl]-4-methylsulfonylaniline (PubChem CID 167436588) has the molecular formula C29H33F3N4O4S and a molecular weight of 590.67 g/mol. Its IUPAC name is 2-methoxy-N-[3-[2-(1-methylpiperidin-4-yl)-7-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[3,2-f][1,4]benzoxazin-8-yl]prop-2-ynyl]-4-methylsulfonylaniline.
| Compound Name | 2-methoxy-N-[3-[2-(1-methylpiperidin-4-yl)-7-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[3,2-f][1,4]benzoxazin-8-yl]prop-2-ynyl]-4-methylsulfonylaniline |
|---|---|
| PubChem CID | 167436588 |
| Molecular Formula | C29H33F3N4O4S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-methoxy-N-[3-[2-(1-methylpiperidin-4-yl)-7-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[3,2-f][1,4]benzoxazin-8-yl]prop-2-ynyl]-4-methylsulfonylaniline |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c3c(ccc2n1CC(F)(F)F)OCC(C1CCN(C)CC1)N3 |
| InChI | InChI=1S/C29H33F3N4O4S/c1-35-13-10-19(11-14-35)24-17-40-26-9-8-25-22(28(26)34-24)15-20(36(25)18-29(30,31)32)5-4-12-33-23-7-6-21(41(3,37)38)16-27(23)39-2/h6-9,15-16,19,24,33-34H,10-14,17-18H2,1-3H3 |
| InChIKey | PTLPLVPLTZAZPB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|