C8H16N2O2 — CID 171531820
(2R)-2-[(dimethylamino)methyl]-5-methylmorpholin-3-one (PubChem CID 171531820) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (2R)-2-[(dimethylamino)methyl]-5-methylmorpholin-3-one.
| Compound Name | (2R)-2-[(dimethylamino)methyl]-5-methylmorpholin-3-one |
|---|---|
| PubChem CID | 171531820 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (2R)-2-[(dimethylamino)methyl]-5-methylmorpholin-3-one |
| SMILES | CC1CO[C@H](CN(C)C)C(=O)N1 |
| InChI | InChI=1S/C8H16N2O2/c1-6-5-12-7(4-10(2)3)8(11)9-6/h6-7H,4-5H2,1-3H3,(H,9,11)/t6?,7-/m1/s1 |
| InChIKey | IGOXUJKAMKNVMA-COBSHVIPSA-N |
| XLogP | -0.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |