C7H14N2O2 — CID 171532110
2-(aminomethyl)-4,5-dimethylmorpholin-3-one (PubChem CID 171532110) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(aminomethyl)-4,5-dimethylmorpholin-3-one.
| Compound Name | 2-(aminomethyl)-4,5-dimethylmorpholin-3-one |
|---|---|
| PubChem CID | 171532110 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(aminomethyl)-4,5-dimethylmorpholin-3-one |
| SMILES | CC1COC(CN)C(=O)N1C |
| InChI | InChI=1S/C7H14N2O2/c1-5-4-11-6(3-8)7(10)9(5)2/h5-6H,3-4,8H2,1-2H3 |
| InChIKey | MHWNUDBQDUHLAQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |