C6H12N2O — CID 20715925
3-(aminomethyl)-1,4-dimethylazetidin-2-one (PubChem CID 20715925) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-(aminomethyl)-1,4-dimethylazetidin-2-one.
| Compound Name | 3-(aminomethyl)-1,4-dimethylazetidin-2-one |
|---|---|
| PubChem CID | 20715925 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 3-(aminomethyl)-1,4-dimethylazetidin-2-one |
| SMILES | CC1C(CN)C(=O)N1C |
| InChI | InChI=1S/C6H12N2O/c1-4-5(3-7)6(9)8(4)2/h4-5H,3,7H2,1-2H3 |
| InChIKey | QAUUHJPBNXBIIN-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |