C7H14NOP — CID 163862461
1,4-dimethyl-3-(2-phosphanylethyl)azetidin-2-one (PubChem CID 163862461) has the molecular formula C7H14NOP and a molecular weight of 159.17 g/mol. Its IUPAC name is 1,4-dimethyl-3-(2-phosphanylethyl)azetidin-2-one.
| Compound Name | 1,4-dimethyl-3-(2-phosphanylethyl)azetidin-2-one |
|---|---|
| PubChem CID | 163862461 |
| Molecular Formula | C7H14NOP |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1,4-dimethyl-3-(2-phosphanylethyl)azetidin-2-one |
| SMILES | CC1C(CCP)C(=O)N1C |
| InChI | InChI=1S/C7H14NOP/c1-5-6(3-4-10)7(9)8(5)2/h5-6H,3-4,10H2,1-2H3 |
| InChIKey | PDTFUMXJMNVASV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|