C7H15N2OP — CID 20715761
1,4-dimethyl-3-[[methyl(phosphanyl)amino]methyl]azetidin-2-one (PubChem CID 20715761) has the molecular formula C7H15N2OP and a molecular weight of 174.18 g/mol. Its IUPAC name is 1,4-dimethyl-3-[[methyl(phosphanyl)amino]methyl]azetidin-2-one.
| Compound Name | 1,4-dimethyl-3-[[methyl(phosphanyl)amino]methyl]azetidin-2-one |
|---|---|
| PubChem CID | 20715761 |
| Molecular Formula | C7H15N2OP |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1,4-dimethyl-3-[[methyl(phosphanyl)amino]methyl]azetidin-2-one |
| SMILES | CC1C(CN(C)P)C(=O)N1C |
| InChI | InChI=1S/C7H15N2OP/c1-5-6(4-8(2)11)7(10)9(5)3/h5-6H,4,11H2,1-3H3 |
| InChIKey | XYZAOYRTTGELTH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|