C6H12N2OS — CID 59888053
5-amino-2,3-dimethyl-1,3-thiazinan-4-one (PubChem CID 59888053) has the molecular formula C6H12N2OS and a molecular weight of 160.24 g/mol. Its IUPAC name is 5-amino-2,3-dimethyl-1,3-thiazinan-4-one.
| Compound Name | 5-amino-2,3-dimethyl-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 59888053 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 5-amino-2,3-dimethyl-1,3-thiazinan-4-one |
| SMILES | CC1SCC(N)C(=O)N1C |
| InChI | InChI=1S/C6H12N2OS/c1-4-8(2)6(9)5(7)3-10-4/h4-5H,3,7H2,1-2H3 |
| InChIKey | SLDSTNTUVGNZTI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |