C20H29NO2 — CID 171532303
(2E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane (PubChem CID 171532303) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (2E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane.
| Compound Name | (2E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 171532303 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (2E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane |
| SMILES | C=C/C=C(\C=C/C)CNCCc1ccc2c(c1)OCCO2.CC |
| InChI | InChI=1S/C18H23NO2.C2H6/c1-3-5-16(6-4-2)14-19-10-9-15-7-8-17-18(13-15)21-12-11-20-17;1-2/h3-8,13,19H,1,9-12,14H2,2H3;1-2H3/b6-4-,16-5+; |
| InChIKey | HZBWGOMPGXUSDW-URQUCTHCSA-N |
| XLogP | 4.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|