C15H21NO2 — CID 171532336
1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)pentan-2-yl]azetidine (PubChem CID 171532336) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)pentan-2-yl]azetidine.
| Compound Name | 1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)pentan-2-yl]azetidine |
|---|---|
| PubChem CID | 171532336 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[(2S,3R)-3-(1,3-benzodioxol-5-yl)pentan-2-yl]azetidine |
| SMILES | CC[C@H](c1ccc2c(c1)OCO2)[C@H](C)N1CCC1 |
| InChI | InChI=1S/C15H21NO2/c1-3-13(11(2)16-7-4-8-16)12-5-6-14-15(9-12)18-10-17-14/h5-6,9,11,13H,3-4,7-8,10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | VPDIUXNHAOKAIB-AAEUAGOBSA-N |
| XLogP | 3.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |