C13H21N3O2 — CID 171534506
2-(4-imidazolidin-1-yl-2,5-dimethoxyphenyl)ethanamine (PubChem CID 171534506) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(4-imidazolidin-1-yl-2,5-dimethoxyphenyl)ethanamine.
| Compound Name | 2-(4-imidazolidin-1-yl-2,5-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 171534506 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-(4-imidazolidin-1-yl-2,5-dimethoxyphenyl)ethanamine |
| SMILES | COc1cc(N2CCNC2)c(OC)cc1CCN |
| InChI | InChI=1S/C13H21N3O2/c1-17-12-8-11(16-6-5-15-9-16)13(18-2)7-10(12)3-4-14/h7-8,15H,3-6,9,14H2,1-2H3 |
| InChIKey | DZZIUYBGQDEQPJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |