C30H37N5O11 — CID 171535954
[1-[4-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]phenyl]-2-morpholin-4-yl-2-oxoethyl] (4-nitrophenyl) carbonate (PubChem CID 171535954) has the molecular formula C30H37N5O11 and a molecular weight of 643.65 g/mol. Its IUPAC name is [1-[4-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]phenyl]-2-morpholin-4-yl-2-oxoethyl] (4-nitrophenyl) carbonate.
| Compound Name | [1-[4-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]phenyl]-2-morpholin-4-yl-2-oxoethyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 171535954 |
| Molecular Formula | C30H37N5O11 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | [1-[4-[[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoyl]amino]phenyl]-2-morpholin-4-yl-2-oxoethyl] (4-nitrophenyl) carbonate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)Nc1ccc(C(OC(=O)Oc2ccc([N+](=O)[O-])cc2)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H37N5O11/c1-18(31-25(36)19(2)32-28(39)46-30(3,4)5)26(37)33-21-8-6-20(7-9-21)24(27(38)34-14-16-43-17-15-34)45-29(40)44-23-12-10-22(11-13-23)35(41)42/h6-13,18-19,24H,14-17H2,1-5H3,(H,31,36)(H,32,39)(H,33,37)/t18-,19-,24?/m0/s1 |
| InChIKey | NGGPJANMCPHLDB-QHEXFSSWSA-N |
| XLogP | 3.07 |
| TPSA | 204.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|