C20H30N4O5 — CID 155047059
tert-butyl N-[(2R,3S)-4-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-4-oxobutan-2-yl]carbamate (PubChem CID 155047059) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-4-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-4-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 155047059 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | tert-butyl N-[(2R,3S)-4-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-4-oxobutan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)[C@@H](C(=O)N1CCN(C)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H30N4O5/c1-14(21-19(26)29-20(2,3)4)17(15-6-8-16(9-7-15)24(27)28)18(25)23-12-10-22(5)11-13-23/h6-9,14,17H,10-13H2,1-5H3,(H,21,26)/t14-,17-/m1/s1 |
| InChIKey | XELNUWAWQYTKQZ-RHSMWYFYSA-N |
| XLogP | 2.37 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|