C17H16N2OS — CID 171536191
N-[(4-methylsulfanylphenyl)methyl]indole-1-carboxamide (PubChem CID 171536191) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methyl]indole-1-carboxamide.
| Compound Name | N-[(4-methylsulfanylphenyl)methyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 171536191 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methyl]indole-1-carboxamide |
| SMILES | CSc1ccc(CNC(=O)n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C17H16N2OS/c1-21-15-8-6-13(7-9-15)12-18-17(20)19-11-10-14-4-2-3-5-16(14)19/h2-11H,12H2,1H3,(H,18,20) |
| InChIKey | NSWBZZKAHDQRIL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |