C22H19FN4O2 — CID 171537189
2-ethyl-4-[4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide (PubChem CID 171537189) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-ethyl-4-[4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide.
| Compound Name | 2-ethyl-4-[4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 171537189 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-ethyl-4-[4-(4-fluoro-1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide |
| SMILES | CCc1cc(-c2cc(Oc3cc(F)c4cnn(C)c4c3)ccn2)ccc1C(N)=O |
| InChI | InChI=1S/C22H19FN4O2/c1-3-13-8-14(4-5-17(13)22(24)28)20-10-15(6-7-25-20)29-16-9-19(23)18-12-26-27(2)21(18)11-16/h4-12H,3H2,1-2H3,(H2,24,28) |
| InChIKey | FHHRCRXGBQIIAH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |