C27H28N4O3 — CID 174252687
2-ethyl-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]-N-(oxan-4-yl)benzamide (PubChem CID 174252687) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-ethyl-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]-N-(oxan-4-yl)benzamide.
| Compound Name | 2-ethyl-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 174252687 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-ethyl-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]-N-(oxan-4-yl)benzamide |
| SMILES | CCc1cc(-c2cc(Oc3ccc4cnn(C)c4c3)ccn2)ccc1C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C27H28N4O3/c1-3-18-14-19(5-7-24(18)27(32)30-21-9-12-33-13-10-21)25-15-23(8-11-28-25)34-22-6-4-20-17-29-31(2)26(20)16-22/h4-8,11,14-17,21H,3,9-10,12-13H2,1-2H3,(H,30,32) |
| InChIKey | ASOIHIZZORCPLD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |