C26H26N6O2 — CID 174250704
2-ethyl-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide (PubChem CID 174250704) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-ethyl-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide.
| Compound Name | 2-ethyl-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 174250704 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-ethyl-N-[(Z)-3-(methylamino)prop-2-enimidoyl]-4-[4-(1-methylindazol-6-yl)oxy-2-pyridinyl]benzamide |
| SMILES | [H]/N=C(\C=C/NC)NC(=O)c1ccc(-c2cc(Oc3ccc4cnn(C)c4c3)ccn2)cc1CC |
| InChI | InChI=1S/C26H26N6O2/c1-4-17-13-18(6-8-22(17)26(33)31-25(27)10-11-28-2)23-14-21(9-12-29-23)34-20-7-5-19-16-30-32(3)24(19)15-20/h5-16,28H,4H2,1-3H3,(H2,27,31,33)/b11-10- |
| InChIKey | RKDHAIIBJRCSPC-KHPPLWFESA-N |
| XLogP | 4.43 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|