C23H24N4O2 — CID 171537685
2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-N-methylbenzamide (PubChem CID 171537685) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-N-methylbenzamide.
| Compound Name | 2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 171537685 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-N-methylbenzamide |
| SMILES | [H]/N=C/c1ccc(Oc2ccnc(-c3ccc(C(=O)NC)c(CC)c3)c2)cc1NC |
| InChI | InChI=1S/C23H24N4O2/c1-4-15-11-16(6-8-20(15)23(28)26-3)22-13-19(9-10-27-22)29-18-7-5-17(14-24)21(12-18)25-2/h5-14,24-25H,4H2,1-3H3,(H,26,28)/b24-14+ |
| InChIKey | ZKDYYRSEDFVLHG-ZVHZXABRSA-N |
| XLogP | 4.50 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|