C22H21N3O2 — CID 174251684
1-[4-[4-(3-amino-4-methanimidoylphenoxy)-2-pyridinyl]-2-ethylphenyl]ethanone (PubChem CID 174251684) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[4-[4-(3-amino-4-methanimidoylphenoxy)-2-pyridinyl]-2-ethylphenyl]ethanone.
| Compound Name | 1-[4-[4-(3-amino-4-methanimidoylphenoxy)-2-pyridinyl]-2-ethylphenyl]ethanone |
|---|---|
| PubChem CID | 174251684 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[4-[4-(3-amino-4-methanimidoylphenoxy)-2-pyridinyl]-2-ethylphenyl]ethanone |
| SMILES | [H]/N=C/c1ccc(Oc2ccnc(-c3ccc(C(C)=O)c(CC)c3)c2)cc1N |
| InChI | InChI=1S/C22H21N3O2/c1-3-15-10-16(5-7-20(15)14(2)26)22-12-19(8-9-25-22)27-18-6-4-17(13-23)21(24)11-18/h4-13,23H,3,24H2,1-2H3/b23-13+ |
| InChIKey | KASSYYUEWJBBPT-YDZHTSKRSA-N |
| XLogP | 4.89 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|