C28H33N5O2 — CID 171537571
N-[3-(dimethylamino)cyclobutyl]-2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]benzamide (PubChem CID 171537571) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N-[3-(dimethylamino)cyclobutyl]-2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]benzamide.
| Compound Name | N-[3-(dimethylamino)cyclobutyl]-2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 171537571 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-[3-(dimethylamino)cyclobutyl]-2-ethyl-4-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]benzamide |
| SMILES | [H]/N=C/c1ccc(Oc2ccnc(-c3ccc(C(=O)NC4CC(N(C)C)C4)c(CC)c3)c2)cc1NC |
| InChI | InChI=1S/C28H33N5O2/c1-5-18-12-19(7-9-25(18)28(34)32-21-13-22(14-21)33(3)4)27-16-24(10-11-31-27)35-23-8-6-20(17-29)26(15-23)30-2/h6-12,15-17,21-22,29-30H,5,13-14H2,1-4H3,(H,32,34)/b29-17+ |
| InChIKey | WZAJHWJRNMOYHD-STBIYBPSSA-N |
| XLogP | 4.97 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|