C30H31N4O2+ — CID 171537599
4-[3-(1,3-dimethylindazol-6-yl)oxyphenyl]-N-(1-ethenylidenepiperidin-1-ium-4-yl)-2-methylbenzamide (PubChem CID 171537599) has the molecular formula C30H31N4O2+ and a molecular weight of 479.60 g/mol. Its IUPAC name is 4-[3-(1,3-dimethylindazol-6-yl)oxyphenyl]-N-(1-ethenylidenepiperidin-1-ium-4-yl)-2-methylbenzamide.
| Compound Name | 4-[3-(1,3-dimethylindazol-6-yl)oxyphenyl]-N-(1-ethenylidenepiperidin-1-ium-4-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 171537599 |
| Molecular Formula | C30H31N4O2+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 4-[3-(1,3-dimethylindazol-6-yl)oxyphenyl]-N-(1-ethenylidenepiperidin-1-ium-4-yl)-2-methylbenzamide |
| SMILES | C=C=[N+]1CCC(NC(=O)c2ccc(-c3cccc(Oc4ccc5c(C)nn(C)c5c4)c3)cc2C)CC1 |
| InChI | InChI=1S/C30H30N4O2/c1-5-34-15-13-24(14-16-34)31-30(35)27-11-9-23(17-20(27)2)22-7-6-8-25(18-22)36-26-10-12-28-21(3)32-33(4)29(28)19-26/h6-12,17-19,24H,1,13-16H2,2-4H3/p+1 |
| InChIKey | KONPMNUVQVBDFQ-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|