C29H35N4O2+ — CID 171537401
1-[2-(methylamino)-4-[3-[3-methyl-4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]phenoxy]phenyl]ethylideneazanium (PubChem CID 171537401) has the molecular formula C29H35N4O2+ and a molecular weight of 471.63 g/mol. Its IUPAC name is 1-[2-(methylamino)-4-[3-[3-methyl-4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]phenoxy]phenyl]ethylideneazanium.
| Compound Name | 1-[2-(methylamino)-4-[3-[3-methyl-4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]phenoxy]phenyl]ethylideneazanium |
|---|---|
| PubChem CID | 171537401 |
| Molecular Formula | C29H35N4O2+ |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 1-[2-(methylamino)-4-[3-[3-methyl-4-[(1-methylpiperidin-4-yl)carbamoyl]phenyl]phenoxy]phenyl]ethylideneazanium |
| SMILES | CNc1cc(Oc2cccc(-c3ccc(C(=O)NC4CCN(C)CC4)c(C)c3)c2)ccc1C(C)=[NH2+] |
| InChI | InChI=1S/C29H34N4O2/c1-19-16-22(8-10-26(19)29(34)32-23-12-14-33(4)15-13-23)21-6-5-7-24(17-21)35-25-9-11-27(20(2)30)28(18-25)31-3/h5-11,16-18,23,30-31H,12-15H2,1-4H3,(H,32,34)/p+1 |
| InChIKey | TZIDTXQPOVTEJG-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|