C29H32N4O2 — CID 171537403
N-(2-azaspiro[3.3]heptan-6-yl)-4-[3-[4-ethanimidoyl-3-(methylamino)phenoxy]phenyl]-2-methylbenzamide (PubChem CID 171537403) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-(2-azaspiro[3.3]heptan-6-yl)-4-[3-[4-ethanimidoyl-3-(methylamino)phenoxy]phenyl]-2-methylbenzamide.
| Compound Name | N-(2-azaspiro[3.3]heptan-6-yl)-4-[3-[4-ethanimidoyl-3-(methylamino)phenoxy]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 171537403 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-(2-azaspiro[3.3]heptan-6-yl)-4-[3-[4-ethanimidoyl-3-(methylamino)phenoxy]phenyl]-2-methylbenzamide |
| SMILES | [H]/N=C(\C)c1ccc(Oc2cccc(-c3ccc(C(=O)NC4CC5(CNC5)C4)c(C)c3)c2)cc1NC |
| InChI | InChI=1S/C29H32N4O2/c1-18-11-21(7-9-25(18)28(34)33-22-14-29(15-22)16-32-17-29)20-5-4-6-23(12-20)35-24-8-10-26(19(2)30)27(13-24)31-3/h4-13,22,30-32H,14-17H2,1-3H3,(H,33,34)/b30-19+ |
| InChIKey | QZSFQVLJLHYLTE-NDZAJKAJSA-N |
| XLogP | 5.37 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|