C27H29N5O2 — CID 171537702
5-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-2-(1-methylpiperidin-4-yl)-3H-isoindol-1-one (PubChem CID 171537702) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 5-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-2-(1-methylpiperidin-4-yl)-3H-isoindol-1-one.
| Compound Name | 5-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-2-(1-methylpiperidin-4-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 171537702 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 5-[4-[4-methanimidoyl-3-(methylamino)phenoxy]-2-pyridinyl]-2-(1-methylpiperidin-4-yl)-3H-isoindol-1-one |
| SMILES | [H]/N=C/c1ccc(Oc2ccnc(-c3ccc4c(c3)CN(C3CCN(C)CC3)C4=O)c2)cc1NC |
| InChI | InChI=1S/C27H29N5O2/c1-29-25-14-22(5-3-19(25)16-28)34-23-7-10-30-26(15-23)18-4-6-24-20(13-18)17-32(27(24)33)21-8-11-31(2)12-9-21/h3-7,10,13-16,21,28-29H,8-9,11-12,17H2,1-2H3/b28-16+ |
| InChIKey | FHMHFLFBMAYEDX-LQKURTRISA-N |
| XLogP | 4.63 |
| TPSA | 81.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|