C21H29FN6 — CID 171540065
6-(4-ethylpiperazin-1-yl)-N-[(3R)-1-(3-fluorophenyl)piperidin-3-yl]pyrimidin-4-amine (PubChem CID 171540065) has the molecular formula C21H29FN6 and a molecular weight of 384.50 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-N-[(3R)-1-(3-fluorophenyl)piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-N-[(3R)-1-(3-fluorophenyl)piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171540065 |
| Molecular Formula | C21H29FN6 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-N-[(3R)-1-(3-fluorophenyl)piperidin-3-yl]pyrimidin-4-amine |
| SMILES | CCN1CCN(c2cc(N[C@@H]3CCCN(c4cccc(F)c4)C3)ncn2)CC1 |
| InChI | InChI=1S/C21H29FN6/c1-2-26-9-11-27(12-10-26)21-14-20(23-16-24-21)25-18-6-4-8-28(15-18)19-7-3-5-17(22)13-19/h3,5,7,13-14,16,18H,2,4,6,8-12,15H2,1H3,(H,23,24,25)/t18-/m1/s1 |
| InChIKey | FNADMEYCAUVXPU-GOSISDBHSA-N |
| XLogP | 2.84 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |