C18H26N4O2S2 — CID 171542479
S-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]thiohydroxylamine;methylsulfanylbenzene (PubChem CID 171542479) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is S-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]thiohydroxylamine;methylsulfanylbenzene.
| Compound Name | S-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]thiohydroxylamine;methylsulfanylbenzene |
|---|---|
| PubChem CID | 171542479 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | S-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]thiohydroxylamine;methylsulfanylbenzene |
| SMILES | CN(C)CCCNc1ccc(SN)cc1[N+](=O)[O-].CSc1ccccc1 |
| InChI | InChI=1S/C11H18N4O2S.C7H8S/c1-14(2)7-3-6-13-10-5-4-9(18-12)8-11(10)15(16)17;1-8-7-5-3-2-4-6-7/h4-5,8,13H,3,6-7,12H2,1-2H3;2-6H,1H3 |
| InChIKey | QKZVDPXGZNOVDX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|