C17H19F3N4O5S2 — CID 171547235
[2-methylsulfanyl-7-oxo-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate (PubChem CID 171547235) has the molecular formula C17H19F3N4O5S2 and a molecular weight of 480.49 g/mol. Its IUPAC name is [2-methylsulfanyl-7-oxo-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-methylsulfanyl-7-oxo-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171547235 |
| Molecular Formula | C17H19F3N4O5S2 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [2-methylsulfanyl-7-oxo-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate |
| SMILES | CCC(=O)N1CCC[C@@H](n2c(=O)cc(OS(=O)(=O)C(F)(F)F)c3cnc(SC)nc32)C1 |
| InChI | InChI=1S/C17H19F3N4O5S2/c1-3-13(25)23-6-4-5-10(9-23)24-14(26)7-12(29-31(27,28)17(18,19)20)11-8-21-16(30-2)22-15(11)24/h7-8,10H,3-6,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | KAVZSOXDCNGUSP-SNVBAGLBSA-N |
| XLogP | 2.32 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|