C21H28N2 — CID 171548736
N-(cyclohexylmethyl)-6-(2,4,6-trimethylphenyl)pyridin-2-amine (PubChem CID 171548736) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-6-(2,4,6-trimethylphenyl)pyridin-2-amine.
| Compound Name | N-(cyclohexylmethyl)-6-(2,4,6-trimethylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171548736 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-(cyclohexylmethyl)-6-(2,4,6-trimethylphenyl)pyridin-2-amine |
| SMILES | Cc1cc(C)c(-c2cccc(NCC3CCCCC3)n2)c(C)c1 |
| InChI | InChI=1S/C21H28N2/c1-15-12-16(2)21(17(3)13-15)19-10-7-11-20(23-19)22-14-18-8-5-4-6-9-18/h7,10-13,18H,4-6,8-9,14H2,1-3H3,(H,22,23) |
| InChIKey | AELIHKSCEQGTNH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |